C24H26N2O4 — CID 23902388
N-[(3R,3'S,5'S)-5'-(2-hydroxyethyl)-3'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,2'-oxolane]-5-yl]-N-phenylformamide (PubChem CID 23902388) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is N-[(3R,3'S,5'S)-5'-(2-hydroxyethyl)-3'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,2'-oxolane]-5-yl]-N-phenylformamide.
| Compound Name | N-[(3R,3'S,5'S)-5'-(2-hydroxyethyl)-3'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,2'-oxolane]-5-yl]-N-phenylformamide |
|---|---|
| PubChem CID | 23902388 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-[(3R,3'S,5'S)-5'-(2-hydroxyethyl)-3'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,2'-oxolane]-5-yl]-N-phenylformamide |
| SMILES | C=CCN1C(=O)[C@]2(O[C@H](CCO)C[C@@H]2C)c2cc(N(C=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C24H26N2O4/c1-3-12-25-22-10-9-19(26(16-28)18-7-5-4-6-8-18)15-21(22)24(23(25)29)17(2)14-20(30-24)11-13-27/h3-10,15-17,20,27H,1,11-14H2,2H3/t17-,20+,24+/m0/s1 |
| InChIKey | SQYQUXYEINXALY-WPSZSDGUSA-N |
| XLogP | 3.52 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|