C25H32FIN2O4 — CID 23902458
(3S,3'R,4'R,5'S)-4'-(2-fluoropropan-2-yl)-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-5-iodo-3'-methyl-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23902458) has the molecular formula C25H32FIN2O4 and a molecular weight of 570.44 g/mol. Its IUPAC name is (3S,3'R,4'R,5'S)-4'-(2-fluoropropan-2-yl)-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-5-iodo-3'-methyl-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'R,4'R,5'S)-4'-(2-fluoropropan-2-yl)-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-5-iodo-3'-methyl-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23902458 |
| Molecular Formula | C25H32FIN2O4 |
| Molecular Weight | 570.44 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | (3S,3'R,4'R,5'S)-4'-(2-fluoropropan-2-yl)-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-5-iodo-3'-methyl-1-prop-2-enylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | C=CCN1C(=O)[C@@]2(O[C@@H](CC(=O)N3CCC[C@H]3CO)[C@H](C(C)(C)F)[C@H]2C)c2cc(I)ccc21 |
| InChI | InChI=1S/C25H32FIN2O4/c1-5-10-29-19-9-8-16(27)12-18(19)25(23(29)32)15(2)22(24(3,4)26)20(33-25)13-21(31)28-11-6-7-17(28)14-30/h5,8-9,12,15,17,20,22,30H,1,6-7,10-11,13-14H2,2-4H3/t15-,17+,20+,22-,25+/m1/s1 |
| InChIKey | BCBVNRSNKBNMSY-NIFGADLGSA-N |
| XLogP | 3.79 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|