C24H20ClN3O6S — CID 23904239
methyl 5-(4-chloro-3-nitrophenyl)-2-[(2-ethoxyphenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 23904239) has the molecular formula C24H20ClN3O6S and a molecular weight of 513.96 g/mol. Its IUPAC name is methyl 5-(4-chloro-3-nitrophenyl)-2-[(2-ethoxyphenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl 5-(4-chloro-3-nitrophenyl)-2-[(2-ethoxyphenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 23904239 |
| Molecular Formula | C24H20ClN3O6S |
| Molecular Weight | 513.96 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | methyl 5-(4-chloro-3-nitrophenyl)-2-[(2-ethoxyphenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOc1ccccc1C=c1sc2n(c1=O)C(c1ccc(Cl)c([N+](=O)[O-])c1)C(C(=O)OC)=C(C)N=2 |
| InChI | InChI=1S/C24H20ClN3O6S/c1-4-34-18-8-6-5-7-14(18)12-19-22(29)27-21(15-9-10-16(25)17(11-15)28(31)32)20(23(30)33-3)13(2)26-24(27)35-19/h5-12,21H,4H2,1-3H3 |
| InChIKey | VANPRHLPIQLJEL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 113.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.96 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|