C29H22ClN3O6S — CID 23987977
methyl 5-(4-chloro-3-nitrophenyl)-7-methyl-3-oxo-2-[(3-phenylmethoxyphenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 23987977) has the molecular formula C29H22ClN3O6S and a molecular weight of 576.03 g/mol. Its IUPAC name is methyl 5-(4-chloro-3-nitrophenyl)-7-methyl-3-oxo-2-[(3-phenylmethoxyphenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl 5-(4-chloro-3-nitrophenyl)-7-methyl-3-oxo-2-[(3-phenylmethoxyphenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 23987977 |
| Molecular Formula | C29H22ClN3O6S |
| Molecular Weight | 576.03 g/mol |
| Exact Mass | 575.09 |
| IUPAC Name | methyl 5-(4-chloro-3-nitrophenyl)-7-methyl-3-oxo-2-[(3-phenylmethoxyphenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=C(C)N=c2sc(=Cc3cccc(OCc4ccccc4)c3)c(=O)n2C1c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H22ClN3O6S/c1-17-25(28(35)38-2)26(20-11-12-22(30)23(15-20)33(36)37)32-27(34)24(40-29(32)31-17)14-19-9-6-10-21(13-19)39-16-18-7-4-3-5-8-18/h3-15,26H,16H2,1-2H3 |
| InChIKey | GVJSNMRDQVNOES-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 113.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.03 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|