C24H14N2O4S2 — CID 23906151
(5-nitro-1-benzofuran-2-yl)-[4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-yl]methanone (PubChem CID 23906151) has the molecular formula C24H14N2O4S2 and a molecular weight of 458.52 g/mol. Its IUPAC name is (5-nitro-1-benzofuran-2-yl)-[4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-yl]methanone.
| Compound Name | (5-nitro-1-benzofuran-2-yl)-[4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-yl]methanone |
|---|---|
| PubChem CID | 23906151 |
| Molecular Formula | C24H14N2O4S2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | (5-nitro-1-benzofuran-2-yl)-[4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-yl]methanone |
| SMILES | O=C(c1cc2cc([N+](=O)[O-])ccc2o1)c1nc(-c2ccc(Sc3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C24H14N2O4S2/c27-23(22-13-16-12-17(26(28)29)8-11-21(16)30-22)24-25-20(14-31-24)15-6-9-19(10-7-15)32-18-4-2-1-3-5-18/h1-14H |
| InChIKey | KTGMJZOXJPLKNV-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|