C15H13NO5S — CID 23909478
methyl 3-(methoxycarbonylamino)-4-(thiophene-2-carbonyl)benzoate (PubChem CID 23909478) has the molecular formula C15H13NO5S and a molecular weight of 319.34 g/mol. Its IUPAC name is methyl 3-(methoxycarbonylamino)-4-(thiophene-2-carbonyl)benzoate.
| Compound Name | methyl 3-(methoxycarbonylamino)-4-(thiophene-2-carbonyl)benzoate |
|---|---|
| PubChem CID | 23909478 |
| Molecular Formula | C15H13NO5S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | methyl 3-(methoxycarbonylamino)-4-(thiophene-2-carbonyl)benzoate |
| SMILES | COC(=O)Nc1cc(C(=O)OC)ccc1C(=O)c1cccs1 |
| InChI | InChI=1S/C15H13NO5S/c1-20-14(18)9-5-6-10(11(8-9)16-15(19)21-2)13(17)12-4-3-7-22-12/h3-8H,1-2H3,(H,16,19) |
| InChIKey | ZFIOATRDHJVHHP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |