C19H16N2O3 — CID 23915920
[2-(4-methylphenyl)-2-oxoethyl] 4-(1H-imidazol-2-yl)benzoate (PubChem CID 23915920) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 4-(1H-imidazol-2-yl)benzoate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 4-(1H-imidazol-2-yl)benzoate |
|---|---|
| PubChem CID | 23915920 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 4-(1H-imidazol-2-yl)benzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccc(-c3ncc[nH]3)cc2)cc1 |
| InChI | InChI=1S/C19H16N2O3/c1-13-2-4-14(5-3-13)17(22)12-24-19(23)16-8-6-15(7-9-16)18-20-10-11-21-18/h2-11H,12H2,1H3,(H,20,21) |
| InChIKey | PWHRMXAAEDLPCY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |