C25H26N2O3S — CID 23917576
3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-methyl-2-propan-2-yl-6-(pyrrolidin-1-ylmethyl)chromen-4-one (PubChem CID 23917576) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-methyl-2-propan-2-yl-6-(pyrrolidin-1-ylmethyl)chromen-4-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-methyl-2-propan-2-yl-6-(pyrrolidin-1-ylmethyl)chromen-4-one |
|---|---|
| PubChem CID | 23917576 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-7-hydroxy-8-methyl-2-propan-2-yl-6-(pyrrolidin-1-ylmethyl)chromen-4-one |
| SMILES | Cc1c(O)c(CN2CCCC2)cc2c(=O)c(-c3nc4ccccc4s3)c(C(C)C)oc12 |
| InChI | InChI=1S/C25H26N2O3S/c1-14(2)23-20(25-26-18-8-4-5-9-19(18)31-25)22(29)17-12-16(13-27-10-6-7-11-27)21(28)15(3)24(17)30-23/h4-5,8-9,12,14,28H,6-7,10-11,13H2,1-3H3 |
| InChIKey | VAALWFYXJHPVQL-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|