C24H26N2O5S — CID 23973608
3-(1,3-benzothiazol-2-yl)-8-[[bis(2-hydroxyethyl)amino]methyl]-7-hydroxy-2-propan-2-ylchromen-4-one (PubChem CID 23973608) has the molecular formula C24H26N2O5S and a molecular weight of 454.55 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-8-[[bis(2-hydroxyethyl)amino]methyl]-7-hydroxy-2-propan-2-ylchromen-4-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-8-[[bis(2-hydroxyethyl)amino]methyl]-7-hydroxy-2-propan-2-ylchromen-4-one |
|---|---|
| PubChem CID | 23973608 |
| Molecular Formula | C24H26N2O5S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-8-[[bis(2-hydroxyethyl)amino]methyl]-7-hydroxy-2-propan-2-ylchromen-4-one |
| SMILES | CC(C)c1oc2c(CN(CCO)CCO)c(O)ccc2c(=O)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H26N2O5S/c1-14(2)22-20(24-25-17-5-3-4-6-19(17)32-24)21(30)15-7-8-18(29)16(23(15)31-22)13-26(9-11-27)10-12-28/h3-8,14,27-29H,9-13H2,1-2H3 |
| InChIKey | LOICQDCMLHPGCV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|