C28H32N2O3S — CID 23889604
3-(1,3-benzothiazol-2-yl)-6-[(2-ethylpiperidin-1-yl)methyl]-7-hydroxy-8-methyl-2-propan-2-ylchromen-4-one (PubChem CID 23889604) has the molecular formula C28H32N2O3S and a molecular weight of 476.64 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-6-[(2-ethylpiperidin-1-yl)methyl]-7-hydroxy-8-methyl-2-propan-2-ylchromen-4-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-6-[(2-ethylpiperidin-1-yl)methyl]-7-hydroxy-8-methyl-2-propan-2-ylchromen-4-one |
|---|---|
| PubChem CID | 23889604 |
| Molecular Formula | C28H32N2O3S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-6-[(2-ethylpiperidin-1-yl)methyl]-7-hydroxy-8-methyl-2-propan-2-ylchromen-4-one |
| SMILES | CCC1CCCCN1Cc1cc2c(=O)c(-c3nc4ccccc4s3)c(C(C)C)oc2c(C)c1O |
| InChI | InChI=1S/C28H32N2O3S/c1-5-19-10-8-9-13-30(19)15-18-14-20-25(32)23(28-29-21-11-6-7-12-22(21)34-28)26(16(2)3)33-27(20)17(4)24(18)31/h6-7,11-12,14,16,19,31H,5,8-10,13,15H2,1-4H3 |
| InChIKey | NZCLQLXIRIPCPQ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|