C34H47N3O4S — CID 23925391
(5S,6S,7R)-2-N-cyclohexyl-3-(6-hydroxyhexyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23925391) has the molecular formula C34H47N3O4S and a molecular weight of 593.83 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-cyclohexyl-3-(6-hydroxyhexyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-cyclohexyl-3-(6-hydroxyhexyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23925391 |
| Molecular Formula | C34H47N3O4S |
| Molecular Weight | 593.83 g/mol |
| Exact Mass | 593.33 |
| IUPAC Name | (5S,6S,7R)-2-N-cyclohexyl-3-(6-hydroxyhexyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)N(CC=C)C3CCCCC3)C23CC[C@H]1S3)c1ccccc1 |
| InChI | InChI=1S/C34H47N3O4S/c1-3-21-35(25-15-9-7-10-16-25)31(39)28-27-19-20-34(42-27)29(28)32(40)37(23-13-5-6-14-24-38)30(34)33(41)36(22-4-2)26-17-11-8-12-18-26/h3-4,7,9-10,15-16,26-30,38H,1-2,5-6,8,11-14,17-24H2/t27-,28+,29+,30?,34?/m1/s1 |
| InChIKey | GJDQYUFJDKVWTN-XWTWWLNUSA-N |
| XLogP | 5.20 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.83 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|