C27H40N2O5S — CID 25089793
prop-2-enyl (5S,6R,7S)-2-[cyclohexyl(prop-2-enyl)carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25089793) has the molecular formula C27H40N2O5S and a molecular weight of 504.69 g/mol. Its IUPAC name is prop-2-enyl (5S,6R,7S)-2-[cyclohexyl(prop-2-enyl)carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | prop-2-enyl (5S,6R,7S)-2-[cyclohexyl(prop-2-enyl)carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25089793 |
| Molecular Formula | C27H40N2O5S |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | prop-2-enyl (5S,6R,7S)-2-[cyclohexyl(prop-2-enyl)carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1[C@@H]2CCC3(S2)C(C(=O)N(CC=C)C2CCCCC2)N(CCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C27H40N2O5S/c1-3-15-28(19-11-7-5-8-12-19)25(32)23-27-14-13-20(35-27)21(26(33)34-18-4-2)22(27)24(31)29(23)16-9-6-10-17-30/h3-4,19-23,30H,1-2,5-18H2/t20-,21+,22-,23?,27?/m0/s1 |
| InChIKey | SDLNCPAYQSSDEA-NJKQDDEASA-N |
| XLogP | 3.32 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|