C29H45N3O4S — CID 25092667
(5S,6S,7R)-2-N-cyclohexyl-3-(4-hydroxybutyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 25092667) has the molecular formula C29H45N3O4S and a molecular weight of 531.76 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-cyclohexyl-3-(4-hydroxybutyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-cyclohexyl-3-(4-hydroxybutyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25092667 |
| Molecular Formula | C29H45N3O4S |
| Molecular Weight | 531.76 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | (5S,6S,7R)-2-N-cyclohexyl-3-(4-hydroxybutyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCC)C(=O)[C@@H]1[C@H]2C(=O)N(CCCCO)C(C(=O)N(CC=C)C3CCCCC3)C23CC[C@H]1S3 |
| InChI | InChI=1S/C29H45N3O4S/c1-4-16-30(17-5-2)26(34)23-22-14-15-29(37-22)24(23)27(35)32(19-10-11-20-33)25(29)28(36)31(18-6-3)21-12-8-7-9-13-21/h4,6,21-25,33H,1,3,5,7-20H2,2H3/t22-,23+,24+,25?,29?/m1/s1 |
| InChIKey | OIVSYSWWNQFXNX-MZQLBTECSA-N |
| XLogP | 3.62 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.76 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|