C27H41N3O4S — CID 25092647
(5S,6S,7R)-2-N-cyclohexyl-3-(2-hydroxyethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 25092647) has the molecular formula C27H41N3O4S and a molecular weight of 503.71 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-cyclohexyl-3-(2-hydroxyethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-cyclohexyl-3-(2-hydroxyethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25092647 |
| Molecular Formula | C27H41N3O4S |
| Molecular Weight | 503.71 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | (5S,6S,7R)-2-N-cyclohexyl-3-(2-hydroxyethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCC)C(=O)[C@@H]1[C@H]2C(=O)N(CCO)C(C(=O)N(CC=C)C3CCCCC3)C23CC[C@H]1S3 |
| InChI | InChI=1S/C27H41N3O4S/c1-4-14-28(15-5-2)24(32)21-20-12-13-27(35-20)22(21)25(33)30(17-18-31)23(27)26(34)29(16-6-3)19-10-8-7-9-11-19/h4,6,19-23,31H,1,3,5,7-18H2,2H3/t20-,21+,22+,23?,27?/m1/s1 |
| InChIKey | XEIQARNYBZYJLO-SAFCFDRRSA-N |
| XLogP | 2.84 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.71 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|