C30H49N3O4S — CID 25092913
(5S,6S,7R)-3-(6-hydroxyhexyl)-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 25092913) has the molecular formula C30H49N3O4S and a molecular weight of 547.81 g/mol. Its IUPAC name is (5S,6S,7R)-3-(6-hydroxyhexyl)-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-3-(6-hydroxyhexyl)-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25092913 |
| Molecular Formula | C30H49N3O4S |
| Molecular Weight | 547.81 g/mol |
| Exact Mass | 547.34 |
| IUPAC Name | (5S,6S,7R)-3-(6-hydroxyhexyl)-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCCCC)C(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)CCC)[C@H]3CCC12S3 |
| InChI | InChI=1S/C30H49N3O4S/c1-5-9-12-20-32(19-8-4)29(37)26-30-16-15-23(38-30)24(27(35)31(17-6-2)18-7-3)25(30)28(36)33(26)21-13-10-11-14-22-34/h6,8,23-26,34H,2,4-5,7,9-22H2,1,3H3/t23-,24+,25+,26?,30?/m1/s1 |
| InChIKey | BKJZFRBKFCRFPM-AZJVQQCOSA-N |
| XLogP | 4.26 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.81 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|