C25H39N3O6S — CID 25088667
(5S,6R,7S)-3-(6-hydroxyhexyl)-2-[2-morpholin-4-ylethyl(prop-2-enyl)carbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 25088667) has the molecular formula C25H39N3O6S and a molecular weight of 509.67 g/mol. Its IUPAC name is (5S,6R,7S)-3-(6-hydroxyhexyl)-2-[2-morpholin-4-ylethyl(prop-2-enyl)carbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (5S,6R,7S)-3-(6-hydroxyhexyl)-2-[2-morpholin-4-ylethyl(prop-2-enyl)carbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 25088667 |
| Molecular Formula | C25H39N3O6S |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | (5S,6R,7S)-3-(6-hydroxyhexyl)-2-[2-morpholin-4-ylethyl(prop-2-enyl)carbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(CCN1CCOCC1)C(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@H](C(=O)O)[C@@H]3CCC12S3 |
| InChI | InChI=1S/C25H39N3O6S/c1-2-9-27(12-11-26-13-16-34-17-14-26)23(31)21-25-8-7-18(35-25)19(24(32)33)20(25)22(30)28(21)10-5-3-4-6-15-29/h2,18-21,29H,1,3-17H2,(H,32,33)/t18-,19+,20-,21?,25?/m0/s1 |
| InChIKey | WALSKEBKHUFUIX-CJEQOKKKSA-N |
| XLogP | 1.06 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|