C25H38N2O5S — CID 25078686
pent-4-enyl (5S,6S,7R)-3-(2-hydroxyethyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25078686) has the molecular formula C25H38N2O5S and a molecular weight of 478.66 g/mol. Its IUPAC name is pent-4-enyl (5S,6S,7R)-3-(2-hydroxyethyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | pent-4-enyl (5S,6S,7R)-3-(2-hydroxyethyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25078686 |
| Molecular Formula | C25H38N2O5S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | pent-4-enyl (5S,6S,7R)-3-(2-hydroxyethyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCOC(=O)[C@@H]1[C@H]2C(=O)N(CCO)C(C(=O)N(CC=C)CCCCC)C23CC[C@H]1S3 |
| InChI | InChI=1S/C25H38N2O5S/c1-4-7-9-14-26(13-6-3)23(30)21-25-12-11-18(33-25)19(24(31)32-17-10-8-5-2)20(25)22(29)27(21)15-16-28/h5-6,18-21,28H,2-4,7-17H2,1H3/t18-,19+,20+,21?,25?/m1/s1 |
| InChIKey | QIIZYLBDZXREPM-HQKJDQIJSA-N |
| XLogP | 2.78 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|