C27H22N2O4 — CID 2392599
N-[3-cyano-4,5-bis(4-methoxyphenyl)furan-2-yl]-4-methylbenzamide (PubChem CID 2392599) has the molecular formula C27H22N2O4 and a molecular weight of 438.48 g/mol. Its IUPAC name is N-[3-cyano-4,5-bis(4-methoxyphenyl)furan-2-yl]-4-methylbenzamide.
| Compound Name | N-[3-cyano-4,5-bis(4-methoxyphenyl)furan-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 2392599 |
| Molecular Formula | C27H22N2O4 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[3-cyano-4,5-bis(4-methoxyphenyl)furan-2-yl]-4-methylbenzamide |
| SMILES | COc1ccc(-c2oc(NC(=O)c3ccc(C)cc3)c(C#N)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H22N2O4/c1-17-4-6-20(7-5-17)26(30)29-27-23(16-28)24(18-8-12-21(31-2)13-9-18)25(33-27)19-10-14-22(32-3)15-11-19/h4-15H,1-3H3,(H,29,30) |
| InChIKey | VJEAXEVRTVZQCK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |