C27H22N2O5 — CID 1242767
N-(3-cyano-4,5-diphenylfuran-2-yl)-3,4,5-trimethoxybenzamide (PubChem CID 1242767) has the molecular formula C27H22N2O5 and a molecular weight of 454.48 g/mol. Its IUPAC name is N-(3-cyano-4,5-diphenylfuran-2-yl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 1242767 |
| Molecular Formula | C27H22N2O5 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2oc(-c3ccccc3)c(-c3ccccc3)c2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C27H22N2O5/c1-31-21-14-19(15-22(32-2)25(21)33-3)26(30)29-27-20(16-28)23(17-10-6-4-7-11-17)24(34-27)18-12-8-5-9-13-18/h4-15H,1-3H3,(H,29,30) |
| InChIKey | AOUKUETUWNLKKU-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 93.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |