C28H24FN3O4 — CID 2393249
(E)-4-[(4-fluorophenyl)methyl-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]amino]-4-oxobut-2-enoic acid (PubChem CID 2393249) has the molecular formula C28H24FN3O4 and a molecular weight of 485.52 g/mol. Its IUPAC name is (E)-4-[(4-fluorophenyl)methyl-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(4-fluorophenyl)methyl-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 2393249 |
| Molecular Formula | C28H24FN3O4 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | (E)-4-[(4-fluorophenyl)methyl-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]amino]-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2CN(Cc2ccc(F)cc2)C(=O)/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C28H24FN3O4/c1-36-25-13-9-21(10-14-25)28-22(19-32(30-28)24-5-3-2-4-6-24)18-31(26(33)15-16-27(34)35)17-20-7-11-23(29)12-8-20/h2-16,19H,17-18H2,1H3,(H,34,35)/b16-15+ |
| InChIKey | MGRQUXPPFSKQOH-FOCLMDBBSA-N |
| XLogP | 4.86 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|