C20H23N3O4 — CID 23936302
4-methyl-2-[[2-[2-(pyridine-3-carbonylamino)phenyl]acetyl]amino]pentanoic acid (PubChem CID 23936302) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-methyl-2-[[2-[2-(pyridine-3-carbonylamino)phenyl]acetyl]amino]pentanoic acid.
| Compound Name | 4-methyl-2-[[2-[2-(pyridine-3-carbonylamino)phenyl]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 23936302 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4-methyl-2-[[2-[2-(pyridine-3-carbonylamino)phenyl]acetyl]amino]pentanoic acid |
| SMILES | CC(C)CC(NC(=O)Cc1ccccc1NC(=O)c1cccnc1)C(=O)O |
| InChI | InChI=1S/C20H23N3O4/c1-13(2)10-17(20(26)27)22-18(24)11-14-6-3-4-8-16(14)23-19(25)15-7-5-9-21-12-15/h3-9,12-13,17H,10-11H2,1-2H3,(H,22,24)(H,23,25)(H,26,27) |
| InChIKey | CUFNSKBAUGLUBR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |