C20H24N6O6 — CID 23938326
1-[2-hydroxy-3-(4-nitrophenoxy)propyl]-4-methyl-3-piperidin-1-ylpyrazolo[4,3-d]pyrimidine-5,7-dione (PubChem CID 23938326) has the molecular formula C20H24N6O6 and a molecular weight of 444.45 g/mol. Its IUPAC name is 1-[2-hydroxy-3-(4-nitrophenoxy)propyl]-4-methyl-3-piperidin-1-ylpyrazolo[4,3-d]pyrimidine-5,7-dione.
| Compound Name | 1-[2-hydroxy-3-(4-nitrophenoxy)propyl]-4-methyl-3-piperidin-1-ylpyrazolo[4,3-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 23938326 |
| Molecular Formula | C20H24N6O6 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1-[2-hydroxy-3-(4-nitrophenoxy)propyl]-4-methyl-3-piperidin-1-ylpyrazolo[4,3-d]pyrimidine-5,7-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1c(N1CCCCC1)nn2CC(O)COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H24N6O6/c1-23-16-17(19(28)21-20(23)29)25(22-18(16)24-9-3-2-4-10-24)11-14(27)12-32-15-7-5-13(6-8-15)26(30)31/h5-8,14,27H,2-4,9-12H2,1H3,(H,21,28,29) |
| InChIKey | YEZCOPJAHGSNEW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|