C27H37N3O5 — CID 23952393
(5R,6R,7R)-6-N-benzyl-2-N-cyclohexyl-7-ethyl-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23952393) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is (5R,6R,7R)-6-N-benzyl-2-N-cyclohexyl-7-ethyl-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-6-N-benzyl-2-N-cyclohexyl-7-ethyl-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23952393 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | (5R,6R,7R)-6-N-benzyl-2-N-cyclohexyl-7-ethyl-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC[C@]12CCC3(O1)C(C(=O)NC1CCCCC1)N(CCO)C(=O)[C@@H]3[C@H]2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H37N3O5/c1-2-26-13-14-27(35-26)21(20(26)23(32)28-17-18-9-5-3-6-10-18)25(34)30(15-16-31)22(27)24(33)29-19-11-7-4-8-12-19/h3,5-6,9-10,19-22,31H,2,4,7-8,11-17H2,1H3,(H,28,32)(H,29,33)/t20-,21-,22?,26+,27?/m0/s1 |
| InChIKey | OQCFBSCMNWUDBQ-SKBQQAGXSA-N |
| XLogP | 1.90 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |