C21H26ClN3O4S — CID 23953790
(5S,6S,7R)-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxypropan-2-yl]-6-N,9-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23953790) has the molecular formula C21H26ClN3O4S and a molecular weight of 451.98 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxypropan-2-yl]-6-N,9-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxypropan-2-yl]-6-N,9-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23953790 |
| Molecular Formula | C21H26ClN3O4S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | (5S,6S,7R)-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxypropan-2-yl]-6-N,9-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@@H]1[C@H]2C(=O)N([C@H](C)CO)C(C(=O)Nc3ccccc3Cl)C23S[C@@H]1CC3C |
| InChI | InChI=1S/C21H26ClN3O4S/c1-10-8-14-15(18(27)23-3)16-20(29)25(11(2)9-26)17(21(10,16)30-14)19(28)24-13-7-5-4-6-12(13)22/h4-7,10-11,14-17,26H,8-9H2,1-3H3,(H,23,27)(H,24,28)/t10?,11-,14-,15+,16+,17?,21?/m1/s1 |
| InChIKey | KDVXOMXDCMRHNE-TWFJGKCVSA-N |
| XLogP | 1.74 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |