C29H36N6O4 — CID 23961376
6-[4-(dimethylamino)phenyl]-2-ethyl-N-(4-methylphenyl)-1,3-dioxo-4-(piperazine-1-carbonyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 23961376) has the molecular formula C29H36N6O4 and a molecular weight of 532.65 g/mol. Its IUPAC name is 6-[4-(dimethylamino)phenyl]-2-ethyl-N-(4-methylphenyl)-1,3-dioxo-4-(piperazine-1-carbonyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | 6-[4-(dimethylamino)phenyl]-2-ethyl-N-(4-methylphenyl)-1,3-dioxo-4-(piperazine-1-carbonyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 23961376 |
| Molecular Formula | C29H36N6O4 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 6-[4-(dimethylamino)phenyl]-2-ethyl-N-(4-methylphenyl)-1,3-dioxo-4-(piperazine-1-carbonyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | CCN1C(=O)C2C(C1=O)C(c1ccc(N(C)C)cc1)N(C(=O)Nc1ccc(C)cc1)C2C(=O)N1CCNCC1 |
| InChI | InChI=1S/C29H36N6O4/c1-5-34-26(36)22-23(27(34)37)25(28(38)33-16-14-30-15-17-33)35(29(39)31-20-10-6-18(2)7-11-20)24(22)19-8-12-21(13-9-19)32(3)4/h6-13,22-25,30H,5,14-17H2,1-4H3,(H,31,39) |
| InChIKey | XBPVQPNNMRZOTD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|