C25H22N4O3 — CID 23963701
methyl 2-[4-[4-[(2-methylphenyl)carbamoyl]anilino]phthalazin-1-yl]acetate (PubChem CID 23963701) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is methyl 2-[4-[4-[(2-methylphenyl)carbamoyl]anilino]phthalazin-1-yl]acetate.
| Compound Name | methyl 2-[4-[4-[(2-methylphenyl)carbamoyl]anilino]phthalazin-1-yl]acetate |
|---|---|
| PubChem CID | 23963701 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | methyl 2-[4-[4-[(2-methylphenyl)carbamoyl]anilino]phthalazin-1-yl]acetate |
| SMILES | COC(=O)Cc1nnc(Nc2ccc(C(=O)Nc3ccccc3C)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H22N4O3/c1-16-7-3-6-10-21(16)27-25(31)17-11-13-18(14-12-17)26-24-20-9-5-4-8-19(20)22(28-29-24)15-23(30)32-2/h3-14H,15H2,1-2H3,(H,26,29)(H,27,31) |
| InChIKey | INAUHRCMLWRATC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |