C24H32N2O3 — CID 46502632
octyl 2-[4-[(2-methylphenyl)carbamoyl]anilino]acetate (PubChem CID 46502632) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is octyl 2-[4-[(2-methylphenyl)carbamoyl]anilino]acetate.
| Compound Name | octyl 2-[4-[(2-methylphenyl)carbamoyl]anilino]acetate |
|---|---|
| PubChem CID | 46502632 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | octyl 2-[4-[(2-methylphenyl)carbamoyl]anilino]acetate |
| SMILES | CCCCCCCCOC(=O)CNc1ccc(C(=O)Nc2ccccc2C)cc1 |
| InChI | InChI=1S/C24H32N2O3/c1-3-4-5-6-7-10-17-29-23(27)18-25-21-15-13-20(14-16-21)24(28)26-22-12-9-8-11-19(22)2/h8-9,11-16,25H,3-7,10,17-18H2,1-2H3,(H,26,28) |
| InChIKey | JSPFEYZCQXOJPP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|