C23H29N3O3S — CID 23966686
N,N-diethyl-4-[[1-(3-methylbutyl)-2-oxoindol-3-ylidene]amino]benzenesulfonamide (PubChem CID 23966686) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is N,N-diethyl-4-[[1-(3-methylbutyl)-2-oxoindol-3-ylidene]amino]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[[1-(3-methylbutyl)-2-oxoindol-3-ylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 23966686 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N,N-diethyl-4-[[1-(3-methylbutyl)-2-oxoindol-3-ylidene]amino]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/N=C2\C(=O)N(CCC(C)C)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H29N3O3S/c1-5-25(6-2)30(28,29)19-13-11-18(12-14-19)24-22-20-9-7-8-10-21(20)26(23(22)27)16-15-17(3)4/h7-14,17H,5-6,15-16H2,1-4H3/b24-22- |
| InChIKey | SVUJNRRMFOXHMI-GYHWCHFESA-N |
| XLogP | 4.23 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|