C26H24ClN3O3S — CID 23995208
1-[(4-chlorophenyl)methyl]-3-(4-piperidin-1-ylsulfonylphenyl)iminoindol-2-one (PubChem CID 23995208) has the molecular formula C26H24ClN3O3S and a molecular weight of 494.02 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(4-piperidin-1-ylsulfonylphenyl)iminoindol-2-one.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(4-piperidin-1-ylsulfonylphenyl)iminoindol-2-one |
|---|---|
| PubChem CID | 23995208 |
| Molecular Formula | C26H24ClN3O3S |
| Molecular Weight | 494.02 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(4-piperidin-1-ylsulfonylphenyl)iminoindol-2-one |
| SMILES | O=C1/C(=N\c2ccc(S(=O)(=O)N3CCCCC3)cc2)c2ccccc2N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H24ClN3O3S/c27-20-10-8-19(9-11-20)18-30-24-7-3-2-6-23(24)25(26(30)31)28-21-12-14-22(15-13-21)34(32,33)29-16-4-1-5-17-29/h2-3,6-15H,1,4-5,16-18H2/b28-25- |
| InChIKey | LMKQJLDMPIXHHD-FVDSYPCUSA-N |
| XLogP | 5.18 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.02 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|