C27H28ClN3O3S — CID 20854834
3-[4-(azepan-1-ylsulfonyl)anilino]-2-[(2-chlorophenyl)methyl]-3H-isoindol-1-one (PubChem CID 20854834) has the molecular formula C27H28ClN3O3S and a molecular weight of 510.06 g/mol. Its IUPAC name is 3-[4-(azepan-1-ylsulfonyl)anilino]-2-[(2-chlorophenyl)methyl]-3H-isoindol-1-one.
| Compound Name | 3-[4-(azepan-1-ylsulfonyl)anilino]-2-[(2-chlorophenyl)methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 20854834 |
| Molecular Formula | C27H28ClN3O3S |
| Molecular Weight | 510.06 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | 3-[4-(azepan-1-ylsulfonyl)anilino]-2-[(2-chlorophenyl)methyl]-3H-isoindol-1-one |
| SMILES | O=C1c2ccccc2C(Nc2ccc(S(=O)(=O)N3CCCCCC3)cc2)N1Cc1ccccc1Cl |
| InChI | InChI=1S/C27H28ClN3O3S/c28-25-12-6-3-9-20(25)19-31-26(23-10-4-5-11-24(23)27(31)32)29-21-13-15-22(16-14-21)35(33,34)30-17-7-1-2-8-18-30/h3-6,9-16,26,29H,1-2,7-8,17-19H2 |
| InChIKey | FQANHKSELJZNCP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.06 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |