C26H26ClN3O3S — CID 20854833
2-[(2-chlorophenyl)methyl]-3-(4-piperidin-1-ylsulfonylanilino)-3H-isoindol-1-one (PubChem CID 20854833) has the molecular formula C26H26ClN3O3S and a molecular weight of 496.03 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-3-(4-piperidin-1-ylsulfonylanilino)-3H-isoindol-1-one.
| Compound Name | 2-[(2-chlorophenyl)methyl]-3-(4-piperidin-1-ylsulfonylanilino)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 20854833 |
| Molecular Formula | C26H26ClN3O3S |
| Molecular Weight | 496.03 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-3-(4-piperidin-1-ylsulfonylanilino)-3H-isoindol-1-one |
| SMILES | O=C1c2ccccc2C(Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)N1Cc1ccccc1Cl |
| InChI | InChI=1S/C26H26ClN3O3S/c27-24-11-5-2-8-19(24)18-30-25(22-9-3-4-10-23(22)26(30)31)28-20-12-14-21(15-13-20)34(32,33)29-16-6-1-7-17-29/h2-5,8-15,25,28H,1,6-7,16-18H2 |
| InChIKey | MZPJHBAZGMOLLI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.03 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |