C17H7ClN4O3S2 — CID 23968012
4-(3-chlorophenyl)-11-thiophen-2-yl-7-thia-1,4,9,12-tetrazatricyclo[6.4.0.02,6]dodeca-2(6),8,11-triene-3,5,10-trione (PubChem CID 23968012) has the molecular formula C17H7ClN4O3S2 and a molecular weight of 414.86 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-11-thiophen-2-yl-7-thia-1,4,9,12-tetrazatricyclo[6.4.0.02,6]dodeca-2(6),8,11-triene-3,5,10-trione.
| Compound Name | 4-(3-chlorophenyl)-11-thiophen-2-yl-7-thia-1,4,9,12-tetrazatricyclo[6.4.0.02,6]dodeca-2(6),8,11-triene-3,5,10-trione |
|---|---|
| PubChem CID | 23968012 |
| Molecular Formula | C17H7ClN4O3S2 |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 413.96 |
| IUPAC Name | 4-(3-chlorophenyl)-11-thiophen-2-yl-7-thia-1,4,9,12-tetrazatricyclo[6.4.0.02,6]dodeca-2(6),8,11-triene-3,5,10-trione |
| SMILES | O=C1c2sc3nc(=O)c(-c4cccs4)nn3c2C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H7ClN4O3S2/c18-8-3-1-4-9(7-8)21-15(24)12-13(16(21)25)27-17-19-14(23)11(20-22(12)17)10-5-2-6-26-10/h1-7H |
| InChIKey | NAUNLCFLMRNSSW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 84.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|