C19H19N3O2S — CID 23973512
3-(4-methylphenyl)sulfanyl-N-(3-oxo-2-phenyl-1H-pyrazol-5-yl)propanamide (PubChem CID 23973512) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfanyl-N-(3-oxo-2-phenyl-1H-pyrazol-5-yl)propanamide.
| Compound Name | 3-(4-methylphenyl)sulfanyl-N-(3-oxo-2-phenyl-1H-pyrazol-5-yl)propanamide |
|---|---|
| PubChem CID | 23973512 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 3-(4-methylphenyl)sulfanyl-N-(3-oxo-2-phenyl-1H-pyrazol-5-yl)propanamide |
| SMILES | Cc1ccc(SCCC(=O)Nc2cc(=O)n(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C19H19N3O2S/c1-14-7-9-16(10-8-14)25-12-11-18(23)20-17-13-19(24)22(21-17)15-5-3-2-4-6-15/h2-10,13,21H,11-12H2,1H3,(H,20,23) |
| InChIKey | ORIYMBZUTYWUFP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |