C32H35BrClN3O5 — CID 23981857
(5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23981857) has the molecular formula C32H35BrClN3O5 and a molecular weight of 657.01 g/mol. Its IUPAC name is (5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23981857 |
| Molecular Formula | C32H35BrClN3O5 |
| Molecular Weight | 657.01 g/mol |
| Exact Mass | 655.14 |
| IUPAC Name | (5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)N(CC=C)c2ccccc2Cl)N([C@@H](CO)Cc2ccccc2)C(=O)[C@H]13 |
| InChI | InChI=1S/C32H35BrClN3O5/c1-4-15-35(3)29(39)25-26-30(40)37(21(19-38)17-20-11-7-6-8-12-20)28(32(26)18-22(33)27(25)42-32)31(41)36(16-5-2)24-14-10-9-13-23(24)34/h4-14,21-22,25-28,38H,1-2,15-19H2,3H3/t21-,22?,25-,26+,27-,28?,32?/m1/s1 |
| InChIKey | NGKPSJHECSTQIW-TVMILUIMSA-N |
| XLogP | 3.86 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.01 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|