C26H39FN4O3Si — CID 23985509
1-[3-[2-[(2R,3S,4R,5S)-4-[fluoro(dimethyl)silyl]-5-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]piperidin-2-one (PubChem CID 23985509) has the molecular formula C26H39FN4O3Si and a molecular weight of 502.71 g/mol. Its IUPAC name is 1-[3-[2-[(2R,3S,4R,5S)-4-[fluoro(dimethyl)silyl]-5-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]piperidin-2-one.
| Compound Name | 1-[3-[2-[(2R,3S,4R,5S)-4-[fluoro(dimethyl)silyl]-5-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]piperidin-2-one |
|---|---|
| PubChem CID | 23985509 |
| Molecular Formula | C26H39FN4O3Si |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | 1-[3-[2-[(2R,3S,4R,5S)-4-[fluoro(dimethyl)silyl]-5-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-3-methyloxolan-2-yl]ethyl]phenyl]piperidin-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CCn2cc(CCO)nn2)O[C@@H]1CCc1cccc(N2CCCCC2=O)c1 |
| InChI | InChI=1S/C26H39FN4O3Si/c1-19-23(11-10-20-7-6-8-22(17-20)31-14-5-4-9-25(31)33)34-24(26(19)35(2,3)27)12-15-30-18-21(13-16-32)28-29-30/h6-8,17-19,23-24,26,32H,4-5,9-16H2,1-3H3/t19-,23+,24-,26+/m0/s1 |
| InChIKey | WQBCICLNHAMALE-CEKSUIHGSA-N |
| XLogP | 4.30 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|