C22H21FN4O6S3 — CID 23987512
diethyl 5-[[2-[[5-[(4-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 23987512) has the molecular formula C22H21FN4O6S3 and a molecular weight of 552.63 g/mol. Its IUPAC name is diethyl 5-[[2-[[5-[(4-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[2-[[5-[(4-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 23987512 |
| Molecular Formula | C22H21FN4O6S3 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.06 |
| IUPAC Name | diethyl 5-[[2-[[5-[(4-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)CSc2nnc(NC(=O)c3ccc(F)cc3)s2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C22H21FN4O6S3/c1-4-32-19(30)15-11(3)16(20(31)33-5-2)35-18(15)24-14(28)10-34-22-27-26-21(36-22)25-17(29)12-6-8-13(23)9-7-12/h6-9H,4-5,10H2,1-3H3,(H,24,28)(H,25,26,29) |
| InChIKey | MZUBOGXLZKHNTK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|