C21H23N5O3S — CID 23988136
3-[[4-(dimethylamino)-3-nitrophenyl]methylideneamino]-2-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 23988136) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)-3-nitrophenyl]methylideneamino]-2-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[[4-(dimethylamino)-3-nitrophenyl]methylideneamino]-2-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23988136 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-[[4-(dimethylamino)-3-nitrophenyl]methylideneamino]-2-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCc1nc2sc3c(c2c(=O)n1N=Cc1ccc(N(C)C)c([N+](=O)[O-])c1)CCCC3 |
| InChI | InChI=1S/C21H23N5O3S/c1-4-18-23-20-19(14-7-5-6-8-17(14)30-20)21(27)25(18)22-12-13-9-10-15(24(2)3)16(11-13)26(28)29/h9-12H,4-8H2,1-3H3 |
| InChIKey | VPARBDREZVQLBW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 93.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|