C18H15N5O6S — CID 136919369
3-[(Z)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 136919369) has the molecular formula C18H15N5O6S and a molecular weight of 429.41 g/mol. Its IUPAC name is 3-[(Z)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(Z)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136919369 |
| Molecular Formula | C18H15N5O6S |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 3-[(Z)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2sc3c(c2c(=O)n1/N=C\c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O)CCCC3 |
| InChI | InChI=1S/C18H15N5O6S/c1-9-20-17-15(12-4-2-3-5-14(12)30-17)18(25)21(9)19-8-10-6-11(22(26)27)7-13(16(10)24)23(28)29/h6-8,24H,2-5H2,1H3/b19-8- |
| InChIKey | FNEULFGAFKMJMJ-UWVJOHFNSA-N |
| XLogP | 3.05 |
| TPSA | 153.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|