C21H19Cl2NO3 — CID 2398866
(4E)-2-(3,4-dichlorophenyl)-4-[[4-(3-methylbutoxy)phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 2398866) has the molecular formula C21H19Cl2NO3 and a molecular weight of 404.29 g/mol. Its IUPAC name is (4E)-2-(3,4-dichlorophenyl)-4-[[4-(3-methylbutoxy)phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(3,4-dichlorophenyl)-4-[[4-(3-methylbutoxy)phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2398866 |
| Molecular Formula | C21H19Cl2NO3 |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | (4E)-2-(3,4-dichlorophenyl)-4-[[4-(3-methylbutoxy)phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | CC(C)CCOc1ccc(/C=C2/N=C(c3ccc(Cl)c(Cl)c3)OC2=O)cc1 |
| InChI | InChI=1S/C21H19Cl2NO3/c1-13(2)9-10-26-16-6-3-14(4-7-16)11-19-21(25)27-20(24-19)15-5-8-17(22)18(23)12-15/h3-8,11-13H,9-10H2,1-2H3/b19-11+ |
| InChIKey | JBBRIOAXMHGQHX-YBFXNURJSA-N |
| XLogP | 5.76 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|