C19H13N3O6 — CID 23993990
(4-oxo-1,2,3-benzotriazin-3-yl)methyl 8-methoxy-2-oxochromene-3-carboxylate (PubChem CID 23993990) has the molecular formula C19H13N3O6 and a molecular weight of 379.33 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl 8-methoxy-2-oxochromene-3-carboxylate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 8-methoxy-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 23993990 |
| Molecular Formula | C19H13N3O6 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl 8-methoxy-2-oxochromene-3-carboxylate |
| SMILES | COc1cccc2cc(C(=O)OCn3nnc4ccccc4c3=O)c(=O)oc12 |
| InChI | InChI=1S/C19H13N3O6/c1-26-15-8-4-5-11-9-13(19(25)28-16(11)15)18(24)27-10-22-17(23)12-6-2-3-7-14(12)20-21-22/h2-9H,10H2,1H3 |
| InChIKey | RTGHBLUZZOUQFC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 113.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|