C15H20ClN2OS+ — CID 2402773
5-chloro-3-[[(2R)-2-ethylpiperidin-1-ium-1-yl]methyl]-1,3-benzoxazole-2-thione (PubChem CID 2402773) has the molecular formula C15H20ClN2OS+ and a molecular weight of 311.86 g/mol. Its IUPAC name is 5-chloro-3-[[(2R)-2-ethylpiperidin-1-ium-1-yl]methyl]-1,3-benzoxazole-2-thione.
| Compound Name | 5-chloro-3-[[(2R)-2-ethylpiperidin-1-ium-1-yl]methyl]-1,3-benzoxazole-2-thione |
|---|---|
| PubChem CID | 2402773 |
| Molecular Formula | C15H20ClN2OS+ |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 5-chloro-3-[[(2R)-2-ethylpiperidin-1-ium-1-yl]methyl]-1,3-benzoxazole-2-thione |
| SMILES | CC[C@@H]1CCCC[NH+]1Cn1c(=S)oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H19ClN2OS/c1-2-12-5-3-4-8-17(12)10-18-13-9-11(16)6-7-14(13)19-15(18)20/h6-7,9,12H,2-5,8,10H2,1H3/p+1/t12-/m1/s1 |
| InChIKey | ISRQBYGQIODALG-GFCCVEGCSA-O |
| XLogP | 3.42 |
| TPSA | 22.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|