C19H30N3O3S2+ — CID 7399751
3-[[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]methyl]-N,N-diethyl-2-sulfanylidene-1,3-benzoxazole-5-sulfonamide (PubChem CID 7399751) has the molecular formula C19H30N3O3S2+ and a molecular weight of 412.60 g/mol. Its IUPAC name is 3-[[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]methyl]-N,N-diethyl-2-sulfanylidene-1,3-benzoxazole-5-sulfonamide.
| Compound Name | 3-[[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]methyl]-N,N-diethyl-2-sulfanylidene-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 7399751 |
| Molecular Formula | C19H30N3O3S2+ |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 3-[[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]methyl]-N,N-diethyl-2-sulfanylidene-1,3-benzoxazole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2oc(=S)n(C[NH+]3C[C@@H](C)C[C@H](C)C3)c2c1 |
| InChI | InChI=1S/C19H29N3O3S2/c1-5-21(6-2)27(23,24)16-7-8-18-17(10-16)22(19(26)25-18)13-20-11-14(3)9-15(4)12-20/h7-8,10,14-15H,5-6,9,11-13H2,1-4H3/p+1/t14-,15-/m0/s1 |
| InChIKey | XNCVVVYCTMUPDD-GJZGRUSLSA-O |
| XLogP | 2.51 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|