C16H22N2O4S2 — CID 2361103
3-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-5-ethylsulfonyl-1,3-benzoxazole-2-thione (PubChem CID 2361103) has the molecular formula C16H22N2O4S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 3-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-5-ethylsulfonyl-1,3-benzoxazole-2-thione.
| Compound Name | 3-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-5-ethylsulfonyl-1,3-benzoxazole-2-thione |
|---|---|
| PubChem CID | 2361103 |
| Molecular Formula | C16H22N2O4S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 3-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-5-ethylsulfonyl-1,3-benzoxazole-2-thione |
| SMILES | CCS(=O)(=O)c1ccc2oc(=S)n(CN3C[C@@H](C)O[C@H](C)C3)c2c1 |
| InChI | InChI=1S/C16H22N2O4S2/c1-4-24(19,20)13-5-6-15-14(7-13)18(16(23)22-15)10-17-8-11(2)21-12(3)9-17/h5-7,11-12H,4,8-10H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | XKHRXPOZEPHPDA-VXGBXAGGSA-N |
| XLogP | 2.82 |
| TPSA | 64.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|