C21H25N3O5S2 — CID 2118516
3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-(4-methoxyphenyl)-2-sulfanylidene-1,3-benzoxazole-5-sulfonamide (PubChem CID 2118516) has the molecular formula C21H25N3O5S2 and a molecular weight of 463.58 g/mol. Its IUPAC name is 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-(4-methoxyphenyl)-2-sulfanylidene-1,3-benzoxazole-5-sulfonamide.
| Compound Name | 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-(4-methoxyphenyl)-2-sulfanylidene-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 2118516 |
| Molecular Formula | C21H25N3O5S2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-N-(4-methoxyphenyl)-2-sulfanylidene-1,3-benzoxazole-5-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc3oc(=S)n(CN4C[C@H](C)O[C@@H](C)C4)c3c2)cc1 |
| InChI | InChI=1S/C21H25N3O5S2/c1-14-11-23(12-15(2)28-14)13-24-19-10-18(8-9-20(19)29-21(24)30)31(25,26)22-16-4-6-17(27-3)7-5-16/h4-10,14-15,22H,11-13H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | GFISAQAFJQPLBW-GJZGRUSLSA-N |
| XLogP | 3.84 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|