C17H27ClN2O4S — CID 168637134
1-chloro-3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propan-2-ol (PubChem CID 168637134) has the molecular formula C17H27ClN2O4S and a molecular weight of 390.93 g/mol. Its IUPAC name is 1-chloro-3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propan-2-ol.
| Compound Name | 1-chloro-3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propan-2-ol |
|---|---|
| PubChem CID | 168637134 |
| Molecular Formula | C17H27ClN2O4S |
| Molecular Weight | 390.93 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 1-chloro-3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propan-2-ol |
| SMILES | CCS(=O)(=O)c1ccc(N2CC(C)OC(C)C2)c(NCC(O)CCl)c1 |
| InChI | InChI=1S/C17H27ClN2O4S/c1-4-25(22,23)15-5-6-17(16(7-15)19-9-14(21)8-18)20-10-12(2)24-13(3)11-20/h5-7,12-14,19,21H,4,8-11H2,1-3H3 |
| InChIKey | CDTPHYNNKJTITD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.93 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|