About 3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propane-1,2-diol
3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propane-1,2-diol (PubChem CID 168593208) has the molecular formula C17H28N2O5S
and a molecular weight of 372.49 g/mol. Its IUPAC name is 3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propane-1,2-diol |
| PubChem CID | 168593208 |
| Molecular Formula | C17H28N2O5S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propane-1,2-diol |
| SMILES | CCS(=O)(=O)c1ccc(N2CC(C)OC(C)C2)c(NCC(O)CO)c1 |
| InChI | InChI=1S/C17H28N2O5S/c1-4-25(22,23)15-5-6-17(16(7-15)18-8-14(21)11-20)19-9-12(2)24-13(3)10-19/h5-7,12-14,18,20-21H,4,8-11H2,1-3H3 |
| InChIKey | CSUDLXGLOHTXME-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propane-1,2-diol?
The IUPAC name of 3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propane-1,2-diol (CID 168593208) is 3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propane-1,2-diol.
What is the SMILES notation for 3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propane-1,2-diol?
The canonical SMILES for 3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propane-1,2-diol is CCS(=O)(=O)c1ccc(N2CC(C)OC(C)C2)c(NCC(O)CO)c1.
What is the InChIKey of 3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propane-1,2-diol?
The InChIKey is CSUDLXGLOHTXME-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O5S/c1-4-25(22,23)15-5-6-17(16(7-15)18-8-14(21)11-20)19-9-12(2)24-13(3)10-19/h5-7,12-14,18,20-21H,4,8-11H2,1-3H3.
What are the key properties of 3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propane-1,2-diol?
3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propane-1,2-diol has a molecular weight of 372.49 g/mol, XLogP of 0.86, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,6-dimethylmorpholin-4-yl)-5-ethylsulfonylanilino]propane-1,2-diol is sourced from PubChem (CID 168593208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).