C23H21ClN3O2+ — CID 2406937
N-(3-amino-1H-isoindol-2-ium-2-yl)-4-[(4-chloro-3-methylphenoxy)methyl]benzamide (PubChem CID 2406937) has the molecular formula C23H21ClN3O2+ and a molecular weight of 406.89 g/mol. Its IUPAC name is N-(3-amino-1H-isoindol-2-ium-2-yl)-4-[(4-chloro-3-methylphenoxy)methyl]benzamide.
| Compound Name | N-(3-amino-1H-isoindol-2-ium-2-yl)-4-[(4-chloro-3-methylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 2406937 |
| Molecular Formula | C23H21ClN3O2+ |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-(3-amino-1H-isoindol-2-ium-2-yl)-4-[(4-chloro-3-methylphenoxy)methyl]benzamide |
| SMILES | Cc1cc(OCc2ccc(C(=O)N[N+]3=C(N)c4ccccc4C3)cc2)ccc1Cl |
| InChI | InChI=1S/C23H20ClN3O2/c1-15-12-19(10-11-21(15)24)29-14-16-6-8-17(9-7-16)23(28)26-27-13-18-4-2-3-5-20(18)22(27)25/h2-12,25H,13-14H2,1H3,(H,26,28)/p+1 |
| InChIKey | IDJSLCDWTFGOMG-UHFFFAOYSA-O |
| XLogP | 3.80 |
| TPSA | 67.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|