C21H17F2NO4S — CID 2410132
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-naphthalen-2-ylsulfanylacetate (PubChem CID 2410132) has the molecular formula C21H17F2NO4S and a molecular weight of 417.43 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-naphthalen-2-ylsulfanylacetate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-naphthalen-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 2410132 |
| Molecular Formula | C21H17F2NO4S |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-naphthalen-2-ylsulfanylacetate |
| SMILES | O=C(COC(=O)CSc1ccc2ccccc2c1)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C21H17F2NO4S/c22-21(23)28-18-8-4-3-7-17(18)24-19(25)12-27-20(26)13-29-16-10-9-14-5-1-2-6-15(14)11-16/h1-11,21H,12-13H2,(H,24,25) |
| InChIKey | KVVUVHBIZBMFDX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |