C20H19NO3S — CID 2500823
N-(2,5-dimethoxyphenyl)-2-naphthalen-2-ylsulfanylacetamide (PubChem CID 2500823) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-naphthalen-2-ylsulfanylacetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-naphthalen-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 2500823 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-naphthalen-2-ylsulfanylacetamide |
| SMILES | COc1ccc(OC)c(NC(=O)CSc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C20H19NO3S/c1-23-16-8-10-19(24-2)18(12-16)21-20(22)13-25-17-9-7-14-5-3-4-6-15(14)11-17/h3-12H,13H2,1-2H3,(H,21,22) |
| InChIKey | RNVQCTAPJQROOH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |