C17H15NO4 — CID 24133424
methyl 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylate (PubChem CID 24133424) has the molecular formula C17H15NO4 and a molecular weight of 297.30 g/mol. Its IUPAC name is methyl 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylate.
| Compound Name | methyl 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 24133424 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | methyl 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylate |
| SMILES | COC(=O)C1=CC2=C(CCCC2=O)N(C1=O)C3=CC=CC=C3 |
| InChI | InChI=1S/C17H15NO4/c1-22-17(21)13-10-12-14(8-5-9-15(12)19)18(16(13)20)11-6-3-2-4-7-11/h2-4,6-7,10H,5,8-9H2,1H3 |
| InChIKey | LMRSDUBPFAFHKI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 63.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | 581 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |